C10H10N6S3 — CID 103336683
[6-methyl-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336683) has the molecular formula C10H10N6S3 and a molecular weight of 310.43 g/mol. Its IUPAC name is [6-methyl-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [6-methyl-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336683 |
| Molecular Formula | C10H10N6S3 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | [6-methyl-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | Cc1nsc(Sc2nc(NN)nc3sc(C)cc23)n1 |
| InChI | InChI=1S/C10H10N6S3/c1-4-3-6-7(17-4)13-9(15-11)14-8(6)18-10-12-5(2)16-19-10/h3H,11H2,1-2H3,(H,13,14,15) |
| InChIKey | MLAIUUUKELVLGI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|