C11H12ClN5S — CID 102927134
[5-chloro-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrimidin-2-yl]hydrazine (PubChem CID 102927134) has the molecular formula C11H12ClN5S and a molecular weight of 281.77 g/mol. Its IUPAC name is [5-chloro-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrimidin-2-yl]hydrazine.
| Compound Name | [5-chloro-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 102927134 |
| Molecular Formula | C11H12ClN5S |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | [5-chloro-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc(C)nc(Sc2nc(NN)ncc2Cl)c1 |
| InChI | InChI=1S/C11H12ClN5S/c1-6-3-7(2)15-9(4-6)18-10-8(12)5-14-11(16-10)17-13/h3-5H,13H2,1-2H3,(H,14,16,17) |
| InChIKey | KNWHGDFELVGQKB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|