C8H13ClN4OS — CID 107772950
3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanylbutan-2-ol (PubChem CID 107772950) has the molecular formula C8H13ClN4OS and a molecular weight of 248.74 g/mol. Its IUPAC name is 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanylbutan-2-ol.
| Compound Name | 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107772950 |
| Molecular Formula | C8H13ClN4OS |
| Molecular Weight | 248.74 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)sulfanylbutan-2-ol |
| SMILES | CC(O)C(C)Sc1nc(NN)ncc1Cl |
| InChI | InChI=1S/C8H13ClN4OS/c1-4(14)5(2)15-7-6(9)3-11-8(12-7)13-10/h3-5,14H,10H2,1-2H3,(H,11,12,13) |
| InChIKey | COPDANDKJQQBBO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|