C8H12N4O — CID 80913802
(4-methyl-6-prop-2-enoxypyrimidin-2-yl)hydrazine (PubChem CID 80913802) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is (4-methyl-6-prop-2-enoxypyrimidin-2-yl)hydrazine.
| Compound Name | (4-methyl-6-prop-2-enoxypyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80913802 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (4-methyl-6-prop-2-enoxypyrimidin-2-yl)hydrazine |
| SMILES | C=CCOc1cc(C)nc(NN)n1 |
| InChI | InChI=1S/C8H12N4O/c1-3-4-13-7-5-6(2)10-8(11-7)12-9/h3,5H,1,4,9H2,2H3,(H,10,11,12) |
| InChIKey | WQHNXYZSBCEECS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|