C15H21N3 — CID 163247902
4-(2,6-dimethylphenyl)-6-methylpyrimidin-2-amine;ethane (PubChem CID 163247902) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-6-methylpyrimidin-2-amine;ethane.
| Compound Name | 4-(2,6-dimethylphenyl)-6-methylpyrimidin-2-amine;ethane |
|---|---|
| PubChem CID | 163247902 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-6-methylpyrimidin-2-amine;ethane |
| SMILES | CC.Cc1cc(-c2c(C)cccc2C)nc(N)n1 |
| InChI | InChI=1S/C13H15N3.C2H6/c1-8-5-4-6-9(2)12(8)11-7-10(3)15-13(14)16-11;1-2/h4-7H,1-3H3,(H2,14,15,16);1-2H3 |
| InChIKey | DQVPOOZDQCKUJL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |