C9H12N2 — CID 74888687
3-ethenyl-4,6-dimethylpyridin-2-amine (PubChem CID 74888687) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-ethenyl-4,6-dimethylpyridin-2-amine.
| Compound Name | 3-ethenyl-4,6-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 74888687 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3-ethenyl-4,6-dimethylpyridin-2-amine |
| SMILES | C=Cc1c(C)cc(C)nc1N |
| InChI | InChI=1S/C9H12N2/c1-4-8-6(2)5-7(3)11-9(8)10/h4-5H,1H2,2-3H3,(H2,10,11) |
| InChIKey | IZOGRVLXVADBIQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |