C9H7F3 — CID 141314724
4-ethenyl-1,2,3-trifluoro-5-methylbenzene (PubChem CID 141314724) has the molecular formula C9H7F3 and a molecular weight of 172.15 g/mol. Its IUPAC name is 4-ethenyl-1,2,3-trifluoro-5-methylbenzene.
| Compound Name | 4-ethenyl-1,2,3-trifluoro-5-methylbenzene |
|---|---|
| PubChem CID | 141314724 |
| Molecular Formula | C9H7F3 |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 4-ethenyl-1,2,3-trifluoro-5-methylbenzene |
| SMILES | C=Cc1c(C)cc(F)c(F)c1F |
| InChI | InChI=1S/C9H7F3/c1-3-6-5(2)4-7(10)9(12)8(6)11/h3-4H,1H2,2H3 |
| InChIKey | AGPFPWNKTSAXFY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|