C13H4F8 — CID 121354347
1,2,3,4,5-pentafluoro-6-(2,3,6-trifluoro-5-methylphenyl)benzene (PubChem CID 121354347) has the molecular formula C13H4F8 and a molecular weight of 312.16 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2,3,6-trifluoro-5-methylphenyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2,3,6-trifluoro-5-methylphenyl)benzene |
|---|---|
| PubChem CID | 121354347 |
| Molecular Formula | C13H4F8 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2,3,6-trifluoro-5-methylphenyl)benzene |
| SMILES | Cc1cc(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C13H4F8/c1-3-2-4(14)8(16)5(7(3)15)6-9(17)11(19)13(21)12(20)10(6)18/h2H,1H3 |
| InChIKey | XPLIYGAMPJBALV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|