C11H13NO — CID 163302498
4-amino-2,3-bis(ethenyl)-6-methylphenol (PubChem CID 163302498) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-amino-2,3-bis(ethenyl)-6-methylphenol.
| Compound Name | 4-amino-2,3-bis(ethenyl)-6-methylphenol |
|---|---|
| PubChem CID | 163302498 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-amino-2,3-bis(ethenyl)-6-methylphenol |
| SMILES | C=Cc1c(N)cc(C)c(O)c1C=C |
| InChI | InChI=1S/C11H13NO/c1-4-8-9(5-2)11(13)7(3)6-10(8)12/h4-6,13H,1-2,12H2,3H3 |
| InChIKey | ORCQNQXEYSAOGX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|