C9H10O2 — CID 151306271
5-ethenyl-3-methylbenzene-1,2-diol (PubChem CID 151306271) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 5-ethenyl-3-methylbenzene-1,2-diol.
| Compound Name | 5-ethenyl-3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 151306271 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 5-ethenyl-3-methylbenzene-1,2-diol |
| SMILES | C=Cc1cc(C)c(O)c(O)c1 |
| InChI | InChI=1S/C9H10O2/c1-3-7-4-6(2)9(11)8(10)5-7/h3-5,10-11H,1H2,2H3 |
| InChIKey | ODMABXQDXMUNAU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|