C12H18O2 — CID 171080128
3-ethenyl-2,5,6-trimethylphenol;methanol (PubChem CID 171080128) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-ethenyl-2,5,6-trimethylphenol;methanol.
| Compound Name | 3-ethenyl-2,5,6-trimethylphenol;methanol |
|---|---|
| PubChem CID | 171080128 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-ethenyl-2,5,6-trimethylphenol;methanol |
| SMILES | C=Cc1cc(C)c(C)c(O)c1C.CO |
| InChI | InChI=1S/C11H14O.CH4O/c1-5-10-6-7(2)8(3)11(12)9(10)4;1-2/h5-6,12H,1H2,2-4H3;2H,1H3 |
| InChIKey | DOPZZCKUVXZRBE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |