C16H16 — CID 174382299
2,7-bis(ethenyl)-3,6-dimethylnaphthalene (PubChem CID 174382299) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,7-bis(ethenyl)-3,6-dimethylnaphthalene.
| Compound Name | 2,7-bis(ethenyl)-3,6-dimethylnaphthalene |
|---|---|
| PubChem CID | 174382299 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,7-bis(ethenyl)-3,6-dimethylnaphthalene |
| SMILES | C=Cc1cc2cc(C=C)c(C)cc2cc1C |
| InChI | InChI=1S/C16H16/c1-5-13-9-16-10-14(6-2)12(4)8-15(16)7-11(13)3/h5-10H,1-2H2,3-4H3 |
| InChIKey | BBTPONVSNKBALJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |