C18H16 — CID 144918355
6,7-bis(ethenyl)-2,3-dihydroanthracene (PubChem CID 144918355) has the molecular formula C18H16 and a molecular weight of 232.33 g/mol. Its IUPAC name is 6,7-bis(ethenyl)-2,3-dihydroanthracene.
| Compound Name | 6,7-bis(ethenyl)-2,3-dihydroanthracene |
|---|---|
| PubChem CID | 144918355 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 6,7-bis(ethenyl)-2,3-dihydroanthracene |
| SMILES | C=Cc1cc2cc3c(cc2cc1C=C)=CCCC=3 |
| InChI | InChI=1S/C18H16/c1-3-13-9-17-11-15-7-5-6-8-16(15)12-18(17)10-14(13)4-2/h3-4,7-12H,1-2,5-6H2 |
| InChIKey | KFBADMPDUOLULV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |