C25H38 — CID 144918354
6,7-bis(ethenyl)-2,3-dihydroanthracene;ethane;methane (PubChem CID 144918354) has the molecular formula C25H38 and a molecular weight of 338.58 g/mol. Its IUPAC name is 6,7-bis(ethenyl)-2,3-dihydroanthracene;ethane;methane.
| Compound Name | 6,7-bis(ethenyl)-2,3-dihydroanthracene;ethane;methane |
|---|---|
| PubChem CID | 144918354 |
| Molecular Formula | C25H38 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 6,7-bis(ethenyl)-2,3-dihydroanthracene;ethane;methane |
| SMILES | C.C=Cc1cc2cc3c(cc2cc1C=C)=CCCC=3.CC.CC.CC |
| InChI | InChI=1S/C18H16.3C2H6.CH4/c1-3-13-9-17-11-15-7-5-6-8-16(15)12-18(17)10-14(13)4-2;3*1-2;/h3-4,7-12H,1-2,5-6H2;3*1-2H3;1H4 |
| InChIKey | JYZJAYPZYJQMQE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |