C16H16 — CID 142416248
2,3-bis(ethenyl)-6,7-didehydronaphthalene;ethane (PubChem CID 142416248) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-6,7-didehydronaphthalene;ethane.
| Compound Name | 2,3-bis(ethenyl)-6,7-didehydronaphthalene;ethane |
|---|---|
| PubChem CID | 142416248 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,3-bis(ethenyl)-6,7-didehydronaphthalene;ethane |
| SMILES | C=Cc1cc2cc#ccc2cc1C=C.CC |
| InChI | InChI=1S/C14H10.C2H6/c1-3-11-9-13-7-5-6-8-14(13)10-12(11)4-2;1-2/h3-4,7-10H,1-2H2;1-2H3 |
| InChIKey | NRZPEPHAIMIZOO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |