About 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene
2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene (PubChem CID 156548633) has the molecular formula C14H17Cl
and a molecular weight of 220.74 g/mol. Its IUPAC name is 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene |
| PubChem CID | 156548633 |
| Molecular Formula | C14H17Cl |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene |
| SMILES | C=Cc1cc(C)c(C)c(C)c1/C=C(\C)Cl |
| InChI | InChI=1S/C14H17Cl/c1-6-13-7-9(2)11(4)12(5)14(13)8-10(3)15/h6-8H,1H2,2-5H3/b10-8+ |
| InChIKey | MGSZPLNUXXVDTF-CSKARUKUSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene?
The IUPAC name of 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene (CID 156548633) is 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene.
What is the SMILES notation for 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene?
The canonical SMILES for 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene is C=Cc1cc(C)c(C)c(C)c1/C=C(\C)Cl.
What is the InChIKey of 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene?
The InChIKey is MGSZPLNUXXVDTF-CSKARUKUSA-N. The full InChI is InChI=1S/C14H17Cl/c1-6-13-7-9(2)11(4)12(5)14(13)8-10(3)15/h6-8H,1H2,2-5H3/b10-8+.
What are the key properties of 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene?
2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene has a molecular weight of 220.74 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-chloroprop-1-enyl]-1-ethenyl-3,4,5-trimethylbenzene is sourced from PubChem (CID 156548633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).