C23H36 — CID 153344480
1,2-bis(ethenyl)-4,5-dimethyl-3-[(Z)-prop-1-enyl]benzene;buta-1,3-diene;ethane (PubChem CID 153344480) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-4,5-dimethyl-3-[(Z)-prop-1-enyl]benzene;buta-1,3-diene;ethane.
| Compound Name | 1,2-bis(ethenyl)-4,5-dimethyl-3-[(Z)-prop-1-enyl]benzene;buta-1,3-diene;ethane |
|---|---|
| PubChem CID | 153344480 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 1,2-bis(ethenyl)-4,5-dimethyl-3-[(Z)-prop-1-enyl]benzene;buta-1,3-diene;ethane |
| SMILES | C=CC=C.C=Cc1cc(C)c(C)c(/C=C\C)c1C=C.CC.CC |
| InChI | InChI=1S/C15H18.C4H6.2C2H6/c1-6-9-15-12(5)11(4)10-13(7-2)14(15)8-3;1-3-4-2;2*1-2/h6-10H,2-3H2,1,4-5H3;3-4H,1-2H2;2*1-2H3/b9-6-;;; |
| InChIKey | WEMBAMLQQSLFGQ-CPNIPSBZSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|