C13H18 — CID 159527924
1,2,3,4-tetramethyl-5-[(Z)-prop-1-enyl]benzene (PubChem CID 159527924) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-5-[(Z)-prop-1-enyl]benzene.
| Compound Name | 1,2,3,4-tetramethyl-5-[(Z)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 159527924 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1,2,3,4-tetramethyl-5-[(Z)-prop-1-enyl]benzene |
| SMILES | C/C=C\c1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C13H18/c1-6-7-13-8-9(2)10(3)11(4)12(13)5/h6-8H,1-5H3/b7-6- |
| InChIKey | IPXPJVAYZOUNBA-SREVYHEPSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |