C12H16 — CID 158430591
1,2,3-trimethyl-4-[(Z)-prop-1-enyl]benzene (PubChem CID 158430591) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1,2,3-trimethyl-4-[(Z)-prop-1-enyl]benzene.
| Compound Name | 1,2,3-trimethyl-4-[(Z)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 158430591 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1,2,3-trimethyl-4-[(Z)-prop-1-enyl]benzene |
| SMILES | C/C=C\c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C12H16/c1-5-6-12-8-7-9(2)10(3)11(12)4/h5-8H,1-4H3/b6-5- |
| InChIKey | OVGFQERTRJRPIP-WAYWQWQTSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |