About ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene
ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene (PubChem CID 145388668) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene.
Molecular Properties
| Compound Name | ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene |
| PubChem CID | 145388668 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene |
| SMILES | C/C=C\c1ccccc1C.CC.CC.CC |
| InChI | InChI=1S/C10H12.3C2H6/c1-3-6-10-8-5-4-7-9(10)2;3*1-2/h3-8H,1-2H3;3*1-2H3/b6-3-;;; |
| InChIKey | GXOGVGZZFURDSV-LNCDPFLUSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene?
The IUPAC name of ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene (CID 145388668) is ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene.
What is the SMILES notation for ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene?
The canonical SMILES for ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene is C/C=C\c1ccccc1C.CC.CC.CC.
What is the InChIKey of ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene?
The InChIKey is GXOGVGZZFURDSV-LNCDPFLUSA-N. The full InChI is InChI=1S/C10H12.3C2H6/c1-3-6-10-8-5-4-7-9(10)2;3*1-2/h3-8H,1-2H3;3*1-2H3/b6-3-;;;.
What are the key properties of ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene?
ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene has a molecular weight of 222.42 g/mol, XLogP of 6.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-2-[(Z)-prop-1-enyl]benzene is sourced from PubChem (CID 145388668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).