About 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene
2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene (PubChem CID 144743897) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene.
Molecular Properties
| Compound Name | 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene |
| PubChem CID | 144743897 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene |
| SMILES | C/C=C\c1ccccc1C.C=C(C)C |
| InChI | InChI=1S/C10H12.C4H8/c1-3-6-10-8-5-4-7-9(10)2;1-4(2)3/h3-8H,1-2H3;1H2,2-3H3/b6-3-; |
| InChIKey | ABUVIVREBFQACD-AQPBACSKSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene?
The IUPAC name of 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene (CID 144743897) is 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene.
What is the SMILES notation for 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene?
The canonical SMILES for 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene is C/C=C\c1ccccc1C.C=C(C)C.
What is the InChIKey of 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene?
The InChIKey is ABUVIVREBFQACD-AQPBACSKSA-N. The full InChI is InChI=1S/C10H12.C4H8/c1-3-6-10-8-5-4-7-9(10)2;1-4(2)3/h3-8H,1-2H3;1H2,2-3H3/b6-3-;.
What are the key properties of 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene?
2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene has a molecular weight of 188.31 g/mol, XLogP of 4.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene;1-methyl-2-[(Z)-prop-1-enyl]benzene is sourced from PubChem (CID 144743897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).