About 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene
3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene (PubChem CID 90753145) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene.
Analyze 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene?
The IUPAC name of 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene (CID 90753145) is 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene.
What is the SMILES notation for 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene?
The canonical SMILES for 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene is CC=Cc1ccc(C)c2c1C(=CC)CC2.
What is the InChIKey of 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene?
The InChIKey is HGIWMSSXEHLYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18/c1-4-6-13-8-7-11(3)14-10-9-12(5-2)15(13)14/h4-8H,9-10H2,1-3H3.
What are the key properties of 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene?
3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene has a molecular weight of 198.31 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylidene-7-methyl-4-prop-1-enyl-1,2-dihydroindene is sourced from PubChem (CID 90753145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).