C31H40 — CID 162275839
1,2,3,4-tetramethyl-5-[(1E,6E)-2,4,5-trimethyl-3-methylidene-7-(2,3,4,5-tetramethylphenyl)hepta-1,4,6-trienyl]benzene (PubChem CID 162275839) has the molecular formula C31H40 and a molecular weight of 412.66 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-5-[(1E,6E)-2,4,5-trimethyl-3-methylidene-7-(2,3,4,5-tetramethylphenyl)hepta-1,4,6-trienyl]benzene.
| Compound Name | 1,2,3,4-tetramethyl-5-[(1E,6E)-2,4,5-trimethyl-3-methylidene-7-(2,3,4,5-tetramethylphenyl)hepta-1,4,6-trienyl]benzene |
|---|---|
| PubChem CID | 162275839 |
| Molecular Formula | C31H40 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 1,2,3,4-tetramethyl-5-[(1E,6E)-2,4,5-trimethyl-3-methylidene-7-(2,3,4,5-tetramethylphenyl)hepta-1,4,6-trienyl]benzene |
| SMILES | C=C(C(C)=C(C)/C=C/c1cc(C)c(C)c(C)c1C)/C(C)=C/c1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C31H40/c1-18(13-14-30-15-19(2)24(7)26(9)28(30)11)22(5)23(6)20(3)16-31-17-21(4)25(8)27(10)29(31)12/h13-17H,6H2,1-5,7-12H3/b14-13+,20-16+,22-18? |
| InChIKey | AKHYATHKPUNVTH-JVIWHDDFSA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|