C13H16O — CID 160558061
(3E)-4-(3,4,5-trimethylphenyl)buta-1,3-dien-2-ol (PubChem CID 160558061) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (3E)-4-(3,4,5-trimethylphenyl)buta-1,3-dien-2-ol.
| Compound Name | (3E)-4-(3,4,5-trimethylphenyl)buta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 160558061 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (3E)-4-(3,4,5-trimethylphenyl)buta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C/c1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C13H16O/c1-9-7-13(6-5-11(3)14)8-10(2)12(9)4/h5-8,14H,3H2,1-2,4H3/b6-5+ |
| InChIKey | QYYGWTFSQSXUIA-AATRIKPKSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|