C13H15F2N — CID 146384225
(1Z,3E)-4-(3,4-difluoro-5-methylphenyl)-N,2-dimethylbuta-1,3-dien-1-amine (PubChem CID 146384225) has the molecular formula C13H15F2N and a molecular weight of 223.27 g/mol. Its IUPAC name is (1Z,3E)-4-(3,4-difluoro-5-methylphenyl)-N,2-dimethylbuta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-4-(3,4-difluoro-5-methylphenyl)-N,2-dimethylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 146384225 |
| Molecular Formula | C13H15F2N |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (1Z,3E)-4-(3,4-difluoro-5-methylphenyl)-N,2-dimethylbuta-1,3-dien-1-amine |
| SMILES | CN/C=C(C)\C=C\c1cc(C)c(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2N/c1-9(8-16-3)4-5-11-6-10(2)13(15)12(14)7-11/h4-8,16H,1-3H3/b5-4+,9-8- |
| InChIKey | FLSVWLDGPNSCDC-PXJZJIAOSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|