C11H10FN — CID 169483304
3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile (PubChem CID 169483304) has the molecular formula C11H10FN and a molecular weight of 175.21 g/mol. Its IUPAC name is 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile.
| Compound Name | 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169483304 |
| Molecular Formula | C11H10FN |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1F |
| InChI | InChI=1S/C11H10FN/c1-8-6-10(4-3-5-13)7-9(2)11(8)12/h3-4,6-7H,1-2H3 |
| InChIKey | ICGWORUZLWUTNA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|