About 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile
3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile (PubChem CID 169483304) has the molecular formula C11H10FN
and a molecular weight of 175.21 g/mol. Its IUPAC name is 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile |
| PubChem CID | 169483304 |
| Molecular Formula | C11H10FN |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1F |
| InChI | InChI=1S/C11H10FN/c1-8-6-10(4-3-5-13)7-9(2)11(8)12/h3-4,6-7H,1-2H3 |
| InChIKey | ICGWORUZLWUTNA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile?
The IUPAC name of 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile (CID 169483304) is 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile.
What is the SMILES notation for 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile?
The canonical SMILES for 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile is Cc1cc(C=CC#N)cc(C)c1F.
What is the InChIKey of 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile?
The InChIKey is ICGWORUZLWUTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN/c1-8-6-10(4-3-5-13)7-9(2)11(8)12/h3-4,6-7H,1-2H3.
What are the key properties of 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile?
3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile has a molecular weight of 175.21 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluoro-3,5-dimethylphenyl)prop-2-enenitrile is sourced from PubChem (CID 169483304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).