C10H5F2NO — CID 169483726
3-(3,5-difluoro-4-formylphenyl)prop-2-enenitrile (PubChem CID 169483726) has the molecular formula C10H5F2NO and a molecular weight of 193.15 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-formylphenyl)prop-2-enenitrile.
| Compound Name | 3-(3,5-difluoro-4-formylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169483726 |
| Molecular Formula | C10H5F2NO |
| Molecular Weight | 193.15 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 3-(3,5-difluoro-4-formylphenyl)prop-2-enenitrile |
| SMILES | N#CC=Cc1cc(F)c(C=O)c(F)c1 |
| InChI | InChI=1S/C10H5F2NO/c11-9-4-7(2-1-3-13)5-10(12)8(9)6-14/h1-2,4-6H |
| InChIKey | UKXLFPWKBNMKOH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|