C19H22N3W3- — CID 159370728
3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile;2,6-dimethylbenzene-4-id-1-amine;tungsten (PubChem CID 159370728) has the molecular formula C19H22N3W3- and a molecular weight of 843.93 g/mol. Its IUPAC name is 3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile;2,6-dimethylbenzene-4-id-1-amine;tungsten.
| Compound Name | 3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile;2,6-dimethylbenzene-4-id-1-amine;tungsten |
|---|---|
| PubChem CID | 159370728 |
| Molecular Formula | C19H22N3W3- |
| Molecular Weight | 843.93 g/mol |
| Exact Mass | 844.03 |
| IUPAC Name | 3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile;2,6-dimethylbenzene-4-id-1-amine;tungsten |
| SMILES | Cc1c[c-]cc(C)c1N.Cc1cc(C=CC#N)cc(C)c1N.[W].[W].[W] |
| InChI | InChI=1S/C11H12N2.C8H10N.3W/c1-8-6-10(4-3-5-12)7-9(2)11(8)13;1-6-4-3-5-7(2)8(6)9;;;/h3-4,6-7H,13H2,1-2H3;4-5H,9H2,1-2H3;;;/q;-1;;; |
| InChIKey | UKMRRZLUGSKFKN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.93 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|