C22H19ClN6 — CID 163760795
(E)-3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile;4-[(4-chloropyrimidin-2-yl)amino]benzonitrile (PubChem CID 163760795) has the molecular formula C22H19ClN6 and a molecular weight of 402.89 g/mol. Its IUPAC name is (E)-3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile;4-[(4-chloropyrimidin-2-yl)amino]benzonitrile.
| Compound Name | (E)-3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile;4-[(4-chloropyrimidin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 163760795 |
| Molecular Formula | C22H19ClN6 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (E)-3-(4-amino-3,5-dimethylphenyl)prop-2-enenitrile;4-[(4-chloropyrimidin-2-yl)amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1N.N#Cc1ccc(Nc2nccc(Cl)n2)cc1 |
| InChI | InChI=1S/C11H7ClN4.C11H12N2/c12-10-5-6-14-11(16-10)15-9-3-1-8(7-13)2-4-9;1-8-6-10(4-3-5-12)7-9(2)11(8)13/h1-6H,(H,14,15,16);3-4,6-7H,13H2,1-2H3/b;4-3+ |
| InChIKey | LXZOLMHADCNSRZ-SCBDLNNBSA-N |
| XLogP | 5.17 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|