C22H15ClN8 — CID 11407680
4-[[6-[2-chloro-4-[(E)-2-cyanoethenyl]-6-methylanilino]-7H-purin-2-yl]amino]benzonitrile (PubChem CID 11407680) has the molecular formula C22H15ClN8 and a molecular weight of 426.87 g/mol. Its IUPAC name is 4-[[6-[2-chloro-4-[(E)-2-cyanoethenyl]-6-methylanilino]-7H-purin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[6-[2-chloro-4-[(E)-2-cyanoethenyl]-6-methylanilino]-7H-purin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 11407680 |
| Molecular Formula | C22H15ClN8 |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-[[6-[2-chloro-4-[(E)-2-cyanoethenyl]-6-methylanilino]-7H-purin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(Cl)c1Nc1nc(Nc2ccc(C#N)cc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C22H15ClN8/c1-13-9-15(3-2-8-24)10-17(23)18(13)29-21-19-20(27-12-26-19)30-22(31-21)28-16-6-4-14(11-25)5-7-16/h2-7,9-10,12H,1H3,(H3,26,27,28,29,30,31)/b3-2+ |
| InChIKey | MVFSTZIACKBNEN-NSCUHMNNSA-N |
| XLogP | 5.21 |
| TPSA | 126.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|