C29H22ClN7O — CID 24763105
N-(3-chlorophenyl)-2-(4-cyanoanilino)-4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]pyrimidine-5-carboxamide (PubChem CID 24763105) has the molecular formula C29H22ClN7O and a molecular weight of 520.00 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(4-cyanoanilino)-4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]pyrimidine-5-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2-(4-cyanoanilino)-4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 24763105 |
| Molecular Formula | C29H22ClN7O |
| Molecular Weight | 520.00 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-(3-chlorophenyl)-2-(4-cyanoanilino)-4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]pyrimidine-5-carboxamide |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Nc1nc(Nc2ccc(C#N)cc2)ncc1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C29H22ClN7O/c1-18-13-21(5-4-12-31)14-19(2)26(18)36-27-25(28(38)34-24-7-3-6-22(30)15-24)17-33-29(37-27)35-23-10-8-20(16-32)9-11-23/h3-11,13-15,17H,1-2H3,(H,34,38)(H2,33,35,36,37)/b5-4+ |
| InChIKey | JCWSCXWIRDYCBV-SNAWJCMRSA-N |
| XLogP | 6.89 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.00 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|