C28H24N8 — CID 73067959
4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-5-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 73067959) has the molecular formula C28H24N8 and a molecular weight of 472.56 g/mol. Its IUPAC name is 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-5-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-5-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 73067959 |
| Molecular Formula | C28H24N8 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-5-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1Nc1nc(Nc2ccc(C#N)cc2)ncc1NCc1cccnc1 |
| InChI | InChI=1S/C28H24N8/c1-19-13-22(5-3-11-29)14-20(2)26(19)35-27-25(32-17-23-6-4-12-31-16-23)18-33-28(36-27)34-24-9-7-21(15-30)8-10-24/h3-10,12-14,16,18,32H,17H2,1-2H3,(H2,33,34,35,36) |
| InChIKey | UFXAVMYMGPNXTJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|