C23H18N6O — CID 72541792
4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-6-formylpyrimidin-2-yl]amino]benzonitrile (PubChem CID 72541792) has the molecular formula C23H18N6O and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-6-formylpyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-6-formylpyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 72541792 |
| Molecular Formula | C23H18N6O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-6-formylpyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1Nc1cc(C=O)nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C23H18N6O/c1-15-10-18(4-3-9-24)11-16(2)22(15)28-21-12-20(14-30)27-23(29-21)26-19-7-5-17(13-25)6-8-19/h3-8,10-12,14H,1-2H3,(H2,26,27,28,29) |
| InChIKey | AJBYVEQJYAZUBP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|