C23H19N7O — CID 123349535
4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-6-(nitrosomethyl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 123349535) has the molecular formula C23H19N7O and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-6-(nitrosomethyl)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-6-(nitrosomethyl)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 123349535 |
| Molecular Formula | C23H19N7O |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-6-(nitrosomethyl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Nc1cc(CN=O)nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C23H19N7O/c1-15-10-18(4-3-9-24)11-16(2)22(15)29-21-12-20(14-26-31)28-23(30-21)27-19-7-5-17(13-25)6-8-19/h3-8,10-12H,14H2,1-2H3,(H2,27,28,29,30)/b4-3+ |
| InChIKey | AZFJWLZYBGAPFW-ONEGZZNKSA-N |
| XLogP | 5.26 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|