C23H22N8 — CID 71735961
4-[[4-[4-[(Z)-2-cyanoethenyl]-2,6-dimethylanilino]-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71735961) has the molecular formula C23H22N8 and a molecular weight of 410.49 g/mol. Its IUPAC name is 4-[[4-[4-[(Z)-2-cyanoethenyl]-2,6-dimethylanilino]-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[(Z)-2-cyanoethenyl]-2,6-dimethylanilino]-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71735961 |
| Molecular Formula | C23H22N8 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-[[4-[4-[(Z)-2-cyanoethenyl]-2,6-dimethylanilino]-6-(dimethylamino)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C\C#N)cc(C)c1Nc1nc(Nc2ccc(C#N)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C23H22N8/c1-15-12-18(6-5-11-24)13-16(2)20(15)27-22-28-21(29-23(30-22)31(3)4)26-19-9-7-17(14-25)8-10-19/h5-10,12-13H,1-4H3,(H2,26,27,28,29,30)/b6-5- |
| InChIKey | PTICYRQSCIWJJT-WAYWQWQTSA-N |
| XLogP | 4.45 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|