C23H19N8+ — CID 123570196
4-[[2-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-7H-purin-9-ium-6-yl]amino]benzonitrile (PubChem CID 123570196) has the molecular formula C23H19N8+ and a molecular weight of 407.46 g/mol. Its IUPAC name is 4-[[2-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-7H-purin-9-ium-6-yl]amino]benzonitrile.
| Compound Name | 4-[[2-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-7H-purin-9-ium-6-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 123570196 |
| Molecular Formula | C23H19N8+ |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-[[2-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-7H-purin-9-ium-6-yl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Nc1nc(Nc2ccc(C#N)cc2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C23H18N8/c1-14-10-17(4-3-9-24)11-15(2)19(14)29-23-30-21-20(26-13-27-21)22(31-23)28-18-7-5-16(12-25)6-8-18/h3-8,10-11,13H,1-2H3,(H3,26,27,28,29,30,31)/p+1/b4-3+ |
| InChIKey | WDKLSSQFUZSBPX-ONEGZZNKSA-O |
| XLogP | 4.28 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|