C24H21IN6O — CID 59535877
4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 59535877) has the molecular formula C24H21IN6O and a molecular weight of 536.38 g/mol. Its IUPAC name is 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 59535877 |
| Molecular Formula | C24H21IN6O |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | COCc1nc(Nc2ccc(C#N)cc2)nc(Nc2c(C)cc(/C=C/C#N)cc2C)c1I |
| InChI | InChI=1S/C24H21IN6O/c1-15-11-18(5-4-10-26)12-16(2)22(15)30-23-21(25)20(14-32-3)29-24(31-23)28-19-8-6-17(13-27)7-9-19/h4-9,11-12H,14H2,1-3H3,(H2,28,29,30,31)/b5-4+ |
| InChIKey | XADSOIRXEGWYOW-SNAWJCMRSA-N |
| XLogP | 5.74 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|