C27H26N6O2 — CID 71589470
4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-(1-hydroxyprop-2-enyl)-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 71589470) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-(1-hydroxyprop-2-enyl)-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-(1-hydroxyprop-2-enyl)-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71589470 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-(1-hydroxyprop-2-enyl)-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | C=CC(O)c1c(COC)nc(Nc2ccc(C#N)cc2)nc1Nc1c(C)cc(/C=C/C#N)cc1C |
| InChI | InChI=1S/C27H26N6O2/c1-5-23(34)24-22(16-35-4)31-27(30-21-10-8-19(15-29)9-11-21)33-26(24)32-25-17(2)13-20(7-6-12-28)14-18(25)3/h5-11,13-14,23,34H,1,16H2,2-4H3,(H2,30,31,32,33)/b7-6+ |
| InChIKey | IHRZUFMESYKZDS-VOTSOKGWSA-N |
| XLogP | 5.35 |
| TPSA | 126.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|