C28H28N6O2 — CID 59535880
4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-(1-ethoxyethenyl)-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 59535880) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-(1-ethoxyethenyl)-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-(1-ethoxyethenyl)-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 59535880 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-(1-ethoxyethenyl)-6-(methoxymethyl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | C=C(OCC)c1c(COC)nc(Nc2ccc(C#N)cc2)nc1Nc1c(C)cc(/C=C/C#N)cc1C |
| InChI | InChI=1S/C28H28N6O2/c1-6-36-20(4)25-24(17-35-5)32-28(31-23-11-9-21(16-30)10-12-23)34-27(25)33-26-18(2)14-22(8-7-13-29)15-19(26)3/h7-12,14-15H,4,6,17H2,1-3,5H3,(H2,31,32,33,34)/b8-7+ |
| InChIKey | BMTPHMAJVGTENE-BQYQJAHWSA-N |
| XLogP | 6.14 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|