C30H25N7O — CID 88915160
4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-[(E)-phenylmethoxyiminomethyl]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 88915160) has the molecular formula C30H25N7O and a molecular weight of 499.58 g/mol. Its IUPAC name is 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-[(E)-phenylmethoxyiminomethyl]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-[(E)-phenylmethoxyiminomethyl]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 88915160 |
| Molecular Formula | C30H25N7O |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-5-[(E)-phenylmethoxyiminomethyl]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Nc1nc(Nc2ccc(C#N)cc2)ncc1/C=N/OCc1ccccc1 |
| InChI | InChI=1S/C30H25N7O/c1-21-15-25(9-6-14-31)16-22(2)28(21)36-29-26(19-34-38-20-24-7-4-3-5-8-24)18-33-30(37-29)35-27-12-10-23(17-32)11-13-27/h3-13,15-16,18-19H,20H2,1-2H3,(H2,33,35,36,37)/b9-6+,34-19+ |
| InChIKey | KTPDADKAFOXAKI-HHBDKZAVSA-N |
| XLogP | 6.54 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|