C23H20N6O — CID 76590317
4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-5-(hydroxymethyl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 76590317) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-5-(hydroxymethyl)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-5-(hydroxymethyl)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 76590317 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-[[4-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-5-(hydroxymethyl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1Nc1nc(Nc2ccc(C#N)cc2)ncc1CO |
| InChI | InChI=1S/C23H20N6O/c1-15-10-18(4-3-9-24)11-16(2)21(15)28-22-19(14-30)13-26-23(29-22)27-20-7-5-17(12-25)6-8-20/h3-8,10-11,13,30H,14H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | GNKVHYAGWBEETB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|