C23H21N7O — CID 76560002
4-[[3-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-1-ethyl-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 76560002) has the molecular formula C23H21N7O and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-[[3-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-1-ethyl-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 4-[[3-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-1-ethyl-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 76560002 |
| Molecular Formula | C23H21N7O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-[[3-[4-(2-cyanoethenyl)-2,6-dimethylanilino]-1-ethyl-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | CCn1nc(Nc2c(C)cc(C=CC#N)cc2C)nc(Nc2ccc(C#N)cc2)c1=O |
| InChI | InChI=1S/C23H21N7O/c1-4-30-22(31)21(26-19-9-7-17(14-25)8-10-19)28-23(29-30)27-20-15(2)12-18(6-5-11-24)13-16(20)3/h5-10,12-13H,4H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | FAVGEEVZFCDKDA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|