C23H20N6O2 — CID 143179990
4-[[3-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-1-ethyl-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 143179990) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-[[3-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-1-ethyl-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 4-[[3-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-1-ethyl-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 143179990 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-[[3-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-1-ethyl-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | CCn1nc(Oc2c(C)cc(/C=C/C#N)cc2C)nc(Nc2ccc(C#N)cc2)c1=O |
| InChI | InChI=1S/C23H20N6O2/c1-4-29-22(30)21(26-19-9-7-17(14-25)8-10-19)27-23(28-29)31-20-15(2)12-18(6-5-11-24)13-16(20)3/h5-10,12-13H,4H2,1-3H3,(H,26,27,28)/b6-5+ |
| InChIKey | CYULOBKMZZBPON-AATRIKPKSA-N |
| XLogP | 4.22 |
| TPSA | 116.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|