C23H20N6O3 — CID 76560000
4-[[3-[4-(2-cyanoethenyl)-2,6-dimethylphenoxy]-1-(2-hydroxyethyl)-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 76560000) has the molecular formula C23H20N6O3 and a molecular weight of 428.45 g/mol. Its IUPAC name is 4-[[3-[4-(2-cyanoethenyl)-2,6-dimethylphenoxy]-1-(2-hydroxyethyl)-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 4-[[3-[4-(2-cyanoethenyl)-2,6-dimethylphenoxy]-1-(2-hydroxyethyl)-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 76560000 |
| Molecular Formula | C23H20N6O3 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-[[3-[4-(2-cyanoethenyl)-2,6-dimethylphenoxy]-1-(2-hydroxyethyl)-6-oxo-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)c(=O)n(CCO)n1 |
| InChI | InChI=1S/C23H20N6O3/c1-15-12-18(4-3-9-24)13-16(2)20(15)32-23-27-21(22(31)29(28-23)10-11-30)26-19-7-5-17(14-25)6-8-19/h3-8,12-13,30H,10-11H2,1-2H3,(H,26,27,28) |
| InChIKey | JXWGCAFICSGQRN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 136.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|