C22H20N6O2 — CID 10476102
(E)-3-[4-[[3-(4-cyanoanilino)-6-methyl-1,2,4-triazin-5-yl]oxy]-3,5-dimethylphenyl]prop-2-enamide (PubChem CID 10476102) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is (E)-3-[4-[[3-(4-cyanoanilino)-6-methyl-1,2,4-triazin-5-yl]oxy]-3,5-dimethylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[[3-(4-cyanoanilino)-6-methyl-1,2,4-triazin-5-yl]oxy]-3,5-dimethylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10476102 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (E)-3-[4-[[3-(4-cyanoanilino)-6-methyl-1,2,4-triazin-5-yl]oxy]-3,5-dimethylphenyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C/C(N)=O)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)nnc1C |
| InChI | InChI=1S/C22H20N6O2/c1-13-10-17(6-9-19(24)29)11-14(2)20(13)30-21-15(3)27-28-22(26-21)25-18-7-4-16(12-23)5-8-18/h4-11H,1-3H3,(H2,24,29)(H,25,26,28)/b9-6+ |
| InChIKey | JEGVDTQVBNFFCL-RMKNXTFCSA-N |
| XLogP | 3.70 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|