C26H23ClN6O2 — CID 154699347
4-[[7-(2-chloroacetyl)-2-(4-cyanoanilino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-yl]oxy]-3,5-dimethylbenzonitrile (PubChem CID 154699347) has the molecular formula C26H23ClN6O2 and a molecular weight of 486.96 g/mol. Its IUPAC name is 4-[[7-(2-chloroacetyl)-2-(4-cyanoanilino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-yl]oxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[[7-(2-chloroacetyl)-2-(4-cyanoanilino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-yl]oxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 154699347 |
| Molecular Formula | C26H23ClN6O2 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 4-[[7-(2-chloroacetyl)-2-(4-cyanoanilino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-yl]oxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)nc2c1CCN(C(=O)CCl)CC2 |
| InChI | InChI=1S/C26H23ClN6O2/c1-16-11-19(15-29)12-17(2)24(16)35-25-21-7-9-33(23(34)13-27)10-8-22(21)31-26(32-25)30-20-5-3-18(14-28)4-6-20/h3-6,11-12H,7-10,13H2,1-2H3,(H,30,31,32) |
| InChIKey | POZXNIQQBNTDHC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|