C23H24N6O — CID 156835004
4-[[4-(4-amino-2,6-dimethylphenoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-2-yl]amino]benzonitrile (PubChem CID 156835004) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 4-[[4-(4-amino-2,6-dimethylphenoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-(4-amino-2,6-dimethylphenoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 156835004 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 4-[[4-(4-amino-2,6-dimethylphenoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)nc2c1CCNCC2 |
| InChI | InChI=1S/C23H24N6O/c1-14-11-17(25)12-15(2)21(14)30-22-19-7-9-26-10-8-20(19)28-23(29-22)27-18-5-3-16(13-24)4-6-18/h3-6,11-12,26H,7-10,25H2,1-2H3,(H,27,28,29) |
| InChIKey | NCNVPFLCJPOBPL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|