C23H27I2N6O- — CID 156834982
4-N-[4-(4-amino-2,6-dimethylphenoxy)-7-(methylidene-λ3-iodanyl)iodanuidyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-2-yl]benzene-1,4-diamine (PubChem CID 156834982) has the molecular formula C23H27I2N6O- and a molecular weight of 657.32 g/mol. Its IUPAC name is 4-N-[4-(4-amino-2,6-dimethylphenoxy)-7-(methylidene-λ3-iodanyl)iodanuidyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-(4-amino-2,6-dimethylphenoxy)-7-(methylidene-λ3-iodanyl)iodanuidyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 156834982 |
| Molecular Formula | C23H27I2N6O- |
| Molecular Weight | 657.32 g/mol |
| Exact Mass | 657.03 |
| IUPAC Name | 4-N-[4-(4-amino-2,6-dimethylphenoxy)-7-(methylidene-λ3-iodanyl)iodanuidyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-2-yl]benzene-1,4-diamine |
| SMILES | C=I[I-]N1CCc2nc(Nc3ccc(N)cc3)nc(Oc3c(C)cc(N)cc3C)c2CC1 |
| InChI | InChI=1S/C23H27I2N6O/c1-14-12-17(27)13-15(2)21(14)32-22-19-8-10-31(25-24-3)11-9-20(19)29-23(30-22)28-18-6-4-16(26)5-7-18/h4-7,12-13H,3,8-11,26-27H2,1-2H3,(H,28,29,30)/q-1 |
| InChIKey | BSQAVVBIGIWBLE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|