C20H19N5O — CID 46191264
4-[[3-amino-6-(4-amino-2,6-dimethylphenoxy)-2-pyridinyl]amino]benzonitrile (PubChem CID 46191264) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 4-[[3-amino-6-(4-amino-2,6-dimethylphenoxy)-2-pyridinyl]amino]benzonitrile.
| Compound Name | 4-[[3-amino-6-(4-amino-2,6-dimethylphenoxy)-2-pyridinyl]amino]benzonitrile |
|---|---|
| PubChem CID | 46191264 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-[[3-amino-6-(4-amino-2,6-dimethylphenoxy)-2-pyridinyl]amino]benzonitrile |
| SMILES | Cc1cc(N)cc(C)c1Oc1ccc(N)c(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C20H19N5O/c1-12-9-15(22)10-13(2)19(12)26-18-8-7-17(23)20(25-18)24-16-5-3-14(11-21)4-6-16/h3-10H,22-23H2,1-2H3,(H,24,25) |
| InChIKey | BGYQQWFMFFUJOY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|