C14H14N4O — CID 115320701
2-[4-[(3-amino-6-methoxy-2-pyridinyl)amino]phenyl]acetonitrile (PubChem CID 115320701) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[4-[(3-amino-6-methoxy-2-pyridinyl)amino]phenyl]acetonitrile.
| Compound Name | 2-[4-[(3-amino-6-methoxy-2-pyridinyl)amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 115320701 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[4-[(3-amino-6-methoxy-2-pyridinyl)amino]phenyl]acetonitrile |
| SMILES | COc1ccc(N)c(Nc2ccc(CC#N)cc2)n1 |
| InChI | InChI=1S/C14H14N4O/c1-19-13-7-6-12(16)14(18-13)17-11-4-2-10(3-5-11)8-9-15/h2-7H,8,16H2,1H3,(H,17,18) |
| InChIKey | DVFWTKFNLTVBHA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |